C24H29NO4 — CID 10069273
(4-ethoxycarbonylphenyl) 4,4-dimethyl-1-propan-2-yl-2,3-dihydroquinoline-6-carboxylate (PubChem CID 10069273) has the molecular formula C24H29NO4 and a molecular weight of 395.50 g/mol. Its IUPAC name is (4-ethoxycarbonylphenyl) 4,4-dimethyl-1-propan-2-yl-2,3-dihydroquinoline-6-carboxylate.
| Compound Name | (4-ethoxycarbonylphenyl) 4,4-dimethyl-1-propan-2-yl-2,3-dihydroquinoline-6-carboxylate |
|---|---|
| PubChem CID | 10069273 |
| Molecular Formula | C24H29NO4 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | (4-ethoxycarbonylphenyl) 4,4-dimethyl-1-propan-2-yl-2,3-dihydroquinoline-6-carboxylate |
| SMILES | CCOC(=O)c1ccc(OC(=O)c2ccc3c(c2)C(C)(C)CCN3C(C)C)cc1 |
| InChI | InChI=1S/C24H29NO4/c1-6-28-22(26)17-7-10-19(11-8-17)29-23(27)18-9-12-21-20(15-18)24(4,5)13-14-25(21)16(2)3/h7-12,15-16H,6,13-14H2,1-5H3 |
| InChIKey | FGJIKCQWQSSVPD-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|