C17H15F4N3OS — CID 10385388
2-[[3-methyl-5-(2,2,3,3-tetrafluoropropoxy)-2-pyridinyl]methylsulfanyl]-1H-benzimidazole (PubChem CID 10385388) has the molecular formula C17H15F4N3OS and a molecular weight of 385.39 g/mol. Its IUPAC name is 2-[[3-methyl-5-(2,2,3,3-tetrafluoropropoxy)-2-pyridinyl]methylsulfanyl]-1H-benzimidazole.
| Compound Name | 2-[[3-methyl-5-(2,2,3,3-tetrafluoropropoxy)-2-pyridinyl]methylsulfanyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 10385388 |
| Molecular Formula | C17H15F4N3OS |
| Molecular Weight | 385.39 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | 2-[[3-methyl-5-(2,2,3,3-tetrafluoropropoxy)-2-pyridinyl]methylsulfanyl]-1H-benzimidazole |
| SMILES | Cc1cc(OCC(F)(F)C(F)F)cnc1CSc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C17H15F4N3OS/c1-10-6-11(25-9-17(20,21)15(18)19)7-22-14(10)8-26-16-23-12-4-2-3-5-13(12)24-16/h2-7,15H,8-9H2,1H3,(H,23,24) |
| InChIKey | XWGIKWQMNDRDNM-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.39 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|