C17H16F3N3OS — CID 142854155
ethene;2-[[4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methylsulfanyl]-1H-benzimidazole (PubChem CID 142854155) has the molecular formula C17H16F3N3OS and a molecular weight of 367.40 g/mol. Its IUPAC name is ethene;2-[[4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methylsulfanyl]-1H-benzimidazole.
| Compound Name | ethene;2-[[4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methylsulfanyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 142854155 |
| Molecular Formula | C17H16F3N3OS |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | ethene;2-[[4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methylsulfanyl]-1H-benzimidazole |
| SMILES | C=C.FC(F)(F)COc1ccnc(CSc2nc3ccccc3[nH]2)c1 |
| InChI | InChI=1S/C15H12F3N3OS.C2H4/c16-15(17,18)9-22-11-5-6-19-10(7-11)8-23-14-20-12-3-1-2-4-13(12)21-14;1-2/h1-7H,8-9H2,(H,20,21);1-2H2 |
| InChIKey | ZCWRFCMOXCTMFC-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|