C23H30O2SSi — CID 10386181
S-tert-butyl (2R,3R)-2-methyl-3-phenyl-3-(1-phenylsiletan-1-yl)oxypropanethioate (PubChem CID 10386181) has the molecular formula C23H30O2SSi and a molecular weight of 398.64 g/mol. Its IUPAC name is S-tert-butyl (2R,3R)-2-methyl-3-phenyl-3-(1-phenylsiletan-1-yl)oxypropanethioate.
| Compound Name | S-tert-butyl (2R,3R)-2-methyl-3-phenyl-3-(1-phenylsiletan-1-yl)oxypropanethioate |
|---|---|
| PubChem CID | 10386181 |
| Molecular Formula | C23H30O2SSi |
| Molecular Weight | 398.64 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | S-tert-butyl (2R,3R)-2-methyl-3-phenyl-3-(1-phenylsiletan-1-yl)oxypropanethioate |
| SMILES | C[C@@H](C(=O)SC(C)(C)C)[C@@H](O[Si]1(c2ccccc2)CCC1)c1ccccc1 |
| InChI | InChI=1S/C23H30O2SSi/c1-18(22(24)26-23(2,3)4)21(19-12-7-5-8-13-19)25-27(16-11-17-27)20-14-9-6-10-15-20/h5-10,12-15,18,21H,11,16-17H2,1-4H3/t18-,21-/m1/s1 |
| InChIKey | BNWKTEUQEHVMSM-WIYYLYMNSA-N |
| XLogP | 5.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.64 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|