C14H27N5O3 — CID 103880918
tert-butyl N-(2-methoxyethyl)-N-[2-[(1-methyltriazol-4-yl)methylamino]ethyl]carbamate (PubChem CID 103880918) has the molecular formula C14H27N5O3 and a molecular weight of 313.40 g/mol. Its IUPAC name is tert-butyl N-(2-methoxyethyl)-N-[2-[(1-methyltriazol-4-yl)methylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-(2-methoxyethyl)-N-[2-[(1-methyltriazol-4-yl)methylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 103880918 |
| Molecular Formula | C14H27N5O3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.21 |
| IUPAC Name | tert-butyl N-(2-methoxyethyl)-N-[2-[(1-methyltriazol-4-yl)methylamino]ethyl]carbamate |
| SMILES | COCCN(CCNCc1cn(C)nn1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H27N5O3/c1-14(2,3)22-13(20)19(8-9-21-5)7-6-15-10-12-11-18(4)17-16-12/h11,15H,6-10H2,1-5H3 |
| InChIKey | NVAIXDRYAHCRTA-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|