C24H28O9 — CID 10389517
dimethyl (1R,2R,3S,4R)-4-(2,4-dimethoxyphenyl)-6-hydroxy-1,5-dimethoxy-1,2,3,4-tetrahydronaphthalene-2,3-dicarboxylate (PubChem CID 10389517) has the molecular formula C24H28O9 and a molecular weight of 460.48 g/mol. Its IUPAC name is dimethyl (1R,2R,3S,4R)-4-(2,4-dimethoxyphenyl)-6-hydroxy-1,5-dimethoxy-1,2,3,4-tetrahydronaphthalene-2,3-dicarboxylate.
| Compound Name | dimethyl (1R,2R,3S,4R)-4-(2,4-dimethoxyphenyl)-6-hydroxy-1,5-dimethoxy-1,2,3,4-tetrahydronaphthalene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 10389517 |
| Molecular Formula | C24H28O9 |
| Molecular Weight | 460.48 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | dimethyl (1R,2R,3S,4R)-4-(2,4-dimethoxyphenyl)-6-hydroxy-1,5-dimethoxy-1,2,3,4-tetrahydronaphthalene-2,3-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H](C(=O)OC)[C@H](c2ccc(OC)cc2OC)c2c(ccc(O)c2OC)[C@@H]1OC |
| InChI | InChI=1S/C24H28O9/c1-28-12-7-8-13(16(11-12)29-2)17-18-14(9-10-15(25)22(18)31-4)21(30-3)20(24(27)33-6)19(17)23(26)32-5/h7-11,17,19-21,25H,1-6H3/t17-,19+,20-,21+/m1/s1 |
| InChIKey | CHQORHMVXAMYIT-PMXSJFBMSA-N |
| XLogP | 2.83 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.48 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |