C26H50O4Si2 — CID 10390540
trimethylsilyl (E,2R,6R,8S,9S)-9-[tert-butyl(dimethyl)silyl]oxy-2,4,6,8-tetramethyl-10-methylidene-7-oxododec-4-enoate (PubChem CID 10390540) has the molecular formula C26H50O4Si2 and a molecular weight of 482.85 g/mol. Its IUPAC name is trimethylsilyl (E,2R,6R,8S,9S)-9-[tert-butyl(dimethyl)silyl]oxy-2,4,6,8-tetramethyl-10-methylidene-7-oxododec-4-enoate.
| Compound Name | trimethylsilyl (E,2R,6R,8S,9S)-9-[tert-butyl(dimethyl)silyl]oxy-2,4,6,8-tetramethyl-10-methylidene-7-oxododec-4-enoate |
|---|---|
| PubChem CID | 10390540 |
| Molecular Formula | C26H50O4Si2 |
| Molecular Weight | 482.85 g/mol |
| Exact Mass | 482.32 |
| IUPAC Name | trimethylsilyl (E,2R,6R,8S,9S)-9-[tert-butyl(dimethyl)silyl]oxy-2,4,6,8-tetramethyl-10-methylidene-7-oxododec-4-enoate |
| SMILES | C=C(CC)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C(=O)[C@H](C)/C=C(\C)C[C@@H](C)C(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C26H50O4Si2/c1-15-19(3)24(29-32(13,14)26(7,8)9)22(6)23(27)20(4)16-18(2)17-21(5)25(28)30-31(10,11)12/h16,20-22,24H,3,15,17H2,1-2,4-14H3/b18-16+/t20-,21-,22-,24-/m1/s1 |
| InChIKey | LVNVARZRXKBGKV-SOVANUSYSA-N |
| XLogP | 7.53 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.85 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|