C30H33N5O3 — CID 10391653
1-[(4aS,8aR)-4-(4-amino-6,7-dimethoxyquinazolin-2-yl)-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]-2-naphthalen-2-ylethanone (PubChem CID 10391653) has the molecular formula C30H33N5O3 and a molecular weight of 511.63 g/mol. Its IUPAC name is 1-[(4aS,8aR)-4-(4-amino-6,7-dimethoxyquinazolin-2-yl)-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]-2-naphthalen-2-ylethanone.
| Compound Name | 1-[(4aS,8aR)-4-(4-amino-6,7-dimethoxyquinazolin-2-yl)-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]-2-naphthalen-2-ylethanone |
|---|---|
| PubChem CID | 10391653 |
| Molecular Formula | C30H33N5O3 |
| Molecular Weight | 511.63 g/mol |
| Exact Mass | 511.26 |
| IUPAC Name | 1-[(4aS,8aR)-4-(4-amino-6,7-dimethoxyquinazolin-2-yl)-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]-2-naphthalen-2-ylethanone |
| SMILES | COc1cc2nc(N3CCN(C(=O)Cc4ccc5ccccc5c4)[C@@H]4CCCC[C@@H]43)nc(N)c2cc1OC |
| InChI | InChI=1S/C30H33N5O3/c1-37-26-17-22-23(18-27(26)38-2)32-30(33-29(22)31)35-14-13-34(24-9-5-6-10-25(24)35)28(36)16-19-11-12-20-7-3-4-8-21(20)15-19/h3-4,7-8,11-12,15,17-18,24-25H,5-6,9-10,13-14,16H2,1-2H3,(H2,31,32,33)/t24-,25+/m1/s1 |
| InChIKey | CMYABLZXUMAVKE-RPBOFIJWSA-N |
| XLogP | 4.58 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.63 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |