C23H29N5O3 — CID 12988015
2-[(4aR,8aS)-4-(5-methylfuran-2-yl)-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]-6,7-dimethoxyquinazolin-4-amine (PubChem CID 12988015) has the molecular formula C23H29N5O3 and a molecular weight of 423.52 g/mol. Its IUPAC name is 2-[(4aR,8aS)-4-(5-methylfuran-2-yl)-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]-6,7-dimethoxyquinazolin-4-amine.
| Compound Name | 2-[(4aR,8aS)-4-(5-methylfuran-2-yl)-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]-6,7-dimethoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 12988015 |
| Molecular Formula | C23H29N5O3 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | 2-[(4aR,8aS)-4-(5-methylfuran-2-yl)-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]-6,7-dimethoxyquinazolin-4-amine |
| SMILES | COc1cc2nc(N3CCN(c4ccc(C)o4)[C@@H]4CCCC[C@@H]43)nc(N)c2cc1OC |
| InChI | InChI=1S/C23H29N5O3/c1-14-8-9-21(31-14)27-10-11-28(18-7-5-4-6-17(18)27)23-25-16-13-20(30-3)19(29-2)12-15(16)22(24)26-23/h8-9,12-13,17-18H,4-7,10-11H2,1-3H3,(H2,24,25,26)/t17-,18+/m1/s1 |
| InChIKey | KIFMBIBXWVYGQK-MSOLQXFVSA-N |
| XLogP | 3.77 |
| TPSA | 89.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |