C18H27Cl2N5O2 — CID 86586310
2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoxalin-1-yl]-6,7-dimethoxyquinazolin-4-amine;dihydrochloride (PubChem CID 86586310) has the molecular formula C18H27Cl2N5O2 and a molecular weight of 416.35 g/mol. Its IUPAC name is 2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoxalin-1-yl]-6,7-dimethoxyquinazolin-4-amine;dihydrochloride.
| Compound Name | 2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoxalin-1-yl]-6,7-dimethoxyquinazolin-4-amine;dihydrochloride |
|---|---|
| PubChem CID | 86586310 |
| Molecular Formula | C18H27Cl2N5O2 |
| Molecular Weight | 416.35 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 2-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoxalin-1-yl]-6,7-dimethoxyquinazolin-4-amine;dihydrochloride |
| SMILES | COc1cc2nc(N3CCN[C@@H]4CCCC[C@@H]43)nc(N)c2cc1OC.Cl.Cl |
| InChI | InChI=1S/C18H25N5O2.2ClH/c1-24-15-9-11-13(10-16(15)25-2)21-18(22-17(11)19)23-8-7-20-12-5-3-4-6-14(12)23;;/h9-10,12,14,20H,3-8H2,1-2H3,(H2,19,21,22);2*1H/t12-,14+;;/m1../s1 |
| InChIKey | XYYHXGDCIAEBKA-DAIKJZOUSA-N |
| XLogP | 2.79 |
| TPSA | 85.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.35 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |