C29H46N2O6 — CID 10391900
[(3aS,5S,6R,6aS)-3a-(heptoxymethyl)-2,2-dimethyl-5-(3-pyrrolidin-1-ylpropyl)-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-6-yl] N-phenylcarbamate (PubChem CID 10391900) has the molecular formula C29H46N2O6 and a molecular weight of 518.70 g/mol. Its IUPAC name is [(3aS,5S,6R,6aS)-3a-(heptoxymethyl)-2,2-dimethyl-5-(3-pyrrolidin-1-ylpropyl)-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-6-yl] N-phenylcarbamate.
| Compound Name | [(3aS,5S,6R,6aS)-3a-(heptoxymethyl)-2,2-dimethyl-5-(3-pyrrolidin-1-ylpropyl)-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-6-yl] N-phenylcarbamate |
|---|---|
| PubChem CID | 10391900 |
| Molecular Formula | C29H46N2O6 |
| Molecular Weight | 518.70 g/mol |
| Exact Mass | 518.34 |
| IUPAC Name | [(3aS,5S,6R,6aS)-3a-(heptoxymethyl)-2,2-dimethyl-5-(3-pyrrolidin-1-ylpropyl)-6,6a-dihydro-5H-furo[2,3-d][1,3]dioxol-6-yl] N-phenylcarbamate |
| SMILES | CCCCCCCOC[C@@]12O[C@@H](CCCN3CCCC3)[C@@H](OC(=O)Nc3ccccc3)[C@@H]1OC(C)(C)O2 |
| InChI | InChI=1S/C29H46N2O6/c1-4-5-6-7-13-21-33-22-29-26(36-28(2,3)37-29)25(34-27(32)30-23-15-9-8-10-16-23)24(35-29)17-14-20-31-18-11-12-19-31/h8-10,15-16,24-26H,4-7,11-14,17-22H2,1-3H3,(H,30,32)/t24-,25+,26-,29-/m0/s1 |
| InChIKey | GLNKNCFEWBSSNS-BVXNIFABSA-N |
| XLogP | 5.71 |
| TPSA | 78.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.70 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|