About phenylcarbamic acid
phenylcarbamic acid (PubChem CID 10392) has the molecular formula C7H7NO2
and a molecular weight of 137.14 g/mol. Its IUPAC name is phenylcarbamic acid.
Molecular Properties
| Compound Name | phenylcarbamic acid |
| PubChem CID | 10392 |
| Molecular Formula | C7H7NO2 |
| Molecular Weight | 137.14 g/mol |
| Exact Mass | 137.05 |
| IUPAC Name | phenylcarbamic acid |
| SMILES | O=C(O)Nc1ccccc1 |
| InChI | InChI=1S/C7H7NO2/c9-7(10)8-6-4-2-1-3-5-6/h1-5,8H,(H,9,10) |
| InChIKey | PWXJULSLLONQHY-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.14 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze phenylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenylcarbamic acid?
The IUPAC name of phenylcarbamic acid (CID 10392) is phenylcarbamic acid.
What is the SMILES notation for phenylcarbamic acid?
The canonical SMILES for phenylcarbamic acid is O=C(O)Nc1ccccc1.
What is the InChIKey of phenylcarbamic acid?
The InChIKey is PWXJULSLLONQHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2/c9-7(10)8-6-4-2-1-3-5-6/h1-5,8H,(H,9,10).
What are the key properties of phenylcarbamic acid?
phenylcarbamic acid has a molecular weight of 137.14 g/mol, XLogP of 1.78, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for phenylcarbamic acid is sourced from PubChem (CID 10392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).