About (propan-2-ylideneamino) N-phenylcarbamate
(propan-2-ylideneamino) N-phenylcarbamate (PubChem CID 17808) has the molecular formula C10H12N2O2
and a molecular weight of 192.22 g/mol. Its IUPAC name is (propan-2-ylideneamino) N-phenylcarbamate.
Molecular Properties
| Compound Name | (propan-2-ylideneamino) N-phenylcarbamate |
| PubChem CID | 17808 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | (propan-2-ylideneamino) N-phenylcarbamate |
| SMILES | CC(C)=NOC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C10H12N2O2/c1-8(2)12-14-10(13)11-9-6-4-3-5-7-9/h3-7H,1-2H3,(H,11,13) |
| InChIKey | LATYTXGNKNKTDS-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (propan-2-ylideneamino) N-phenylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (propan-2-ylideneamino) N-phenylcarbamate?
The IUPAC name of (propan-2-ylideneamino) N-phenylcarbamate (CID 17808) is (propan-2-ylideneamino) N-phenylcarbamate.
What is the SMILES notation for (propan-2-ylideneamino) N-phenylcarbamate?
The canonical SMILES for (propan-2-ylideneamino) N-phenylcarbamate is CC(C)=NOC(=O)Nc1ccccc1.
What is the InChIKey of (propan-2-ylideneamino) N-phenylcarbamate?
The InChIKey is LATYTXGNKNKTDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O2/c1-8(2)12-14-10(13)11-9-6-4-3-5-7-9/h3-7H,1-2H3,(H,11,13).
What are the key properties of (propan-2-ylideneamino) N-phenylcarbamate?
(propan-2-ylideneamino) N-phenylcarbamate has a molecular weight of 192.22 g/mol, XLogP of 2.63, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (propan-2-ylideneamino) N-phenylcarbamate is sourced from PubChem (CID 17808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).