About butyl N-phenylcarbamate
butyl N-phenylcarbamate (PubChem CID 15233) has the molecular formula C11H15NO2
and a molecular weight of 193.25 g/mol. Its IUPAC name is butyl N-phenylcarbamate.
Molecular Properties
| Compound Name | butyl N-phenylcarbamate |
| PubChem CID | 15233 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | butyl N-phenylcarbamate |
| SMILES | CCCCOC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C11H15NO2/c1-2-3-9-14-11(13)12-10-7-5-4-6-8-10/h4-8H,2-3,9H2,1H3,(H,12,13) |
| InChIKey | ZTIMKJROOYMUMU-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl N-phenylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl N-phenylcarbamate?
The IUPAC name of butyl N-phenylcarbamate (CID 15233) is butyl N-phenylcarbamate.
What is the SMILES notation for butyl N-phenylcarbamate?
The canonical SMILES for butyl N-phenylcarbamate is CCCCOC(=O)Nc1ccccc1.
What is the InChIKey of butyl N-phenylcarbamate?
The InChIKey is ZTIMKJROOYMUMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2/c1-2-3-9-14-11(13)12-10-7-5-4-6-8-10/h4-8H,2-3,9H2,1H3,(H,12,13).
What are the key properties of butyl N-phenylcarbamate?
butyl N-phenylcarbamate has a molecular weight of 193.25 g/mol, XLogP of 3.04, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butyl N-phenylcarbamate is sourced from PubChem (CID 15233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).