C30H48O8 — CID 10392404
[(2R,3S,4S,5R,6S)-4-acetyloxy-6-[(E)-6-[(1S,3E,7E)-4,8-dimethylcyclodeca-3,7-dien-1-yl]-2-methylhept-5-en-2-yl]oxy-3,5-dihydroxyoxan-2-yl]methyl acetate (PubChem CID 10392404) has the molecular formula C30H48O8 and a molecular weight of 536.71 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-4-acetyloxy-6-[(E)-6-[(1S,3E,7E)-4,8-dimethylcyclodeca-3,7-dien-1-yl]-2-methylhept-5-en-2-yl]oxy-3,5-dihydroxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6S)-4-acetyloxy-6-[(E)-6-[(1S,3E,7E)-4,8-dimethylcyclodeca-3,7-dien-1-yl]-2-methylhept-5-en-2-yl]oxy-3,5-dihydroxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10392404 |
| Molecular Formula | C30H48O8 |
| Molecular Weight | 536.71 g/mol |
| Exact Mass | 536.33 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-4-acetyloxy-6-[(E)-6-[(1S,3E,7E)-4,8-dimethylcyclodeca-3,7-dien-1-yl]-2-methylhept-5-en-2-yl]oxy-3,5-dihydroxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](OC(C)(C)CC/C=C(\C)[C@@H]2C/C=C(\C)CC/C=C(\C)CC2)[C@H](O)[C@@H](OC(C)=O)[C@H]1O |
| InChI | InChI=1S/C30H48O8/c1-19-10-8-11-20(2)14-16-24(15-13-19)21(3)12-9-17-30(6,7)38-29-27(34)28(36-23(5)32)26(33)25(37-29)18-35-22(4)31/h10,12,14,24-29,33-34H,8-9,11,13,15-18H2,1-7H3/b19-10+,20-14+,21-12+/t24-,25+,26-,27+,28-,29-/m0/s1 |
| InChIKey | UQBXPJSEBVIDIT-VQGBBKTLSA-N |
| XLogP | 4.92 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.71 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|