C29H47NO7S2 — CID 10393518
[(3S,4R,5R)-3-acetamido-4-acetyloxy-5-[(E)-9-(2-hexyl-1,3-dithiolan-2-yl)non-2-enyl]-2-oxooxolan-3-yl]methyl acetate (PubChem CID 10393518) has the molecular formula C29H47NO7S2 and a molecular weight of 585.83 g/mol. Its IUPAC name is [(3S,4R,5R)-3-acetamido-4-acetyloxy-5-[(E)-9-(2-hexyl-1,3-dithiolan-2-yl)non-2-enyl]-2-oxooxolan-3-yl]methyl acetate.
| Compound Name | [(3S,4R,5R)-3-acetamido-4-acetyloxy-5-[(E)-9-(2-hexyl-1,3-dithiolan-2-yl)non-2-enyl]-2-oxooxolan-3-yl]methyl acetate |
|---|---|
| PubChem CID | 10393518 |
| Molecular Formula | C29H47NO7S2 |
| Molecular Weight | 585.83 g/mol |
| Exact Mass | 585.28 |
| IUPAC Name | [(3S,4R,5R)-3-acetamido-4-acetyloxy-5-[(E)-9-(2-hexyl-1,3-dithiolan-2-yl)non-2-enyl]-2-oxooxolan-3-yl]methyl acetate |
| SMILES | CCCCCCC1(CCCCCC/C=C/C[C@H]2OC(=O)[C@@](COC(C)=O)(NC(C)=O)[C@H]2OC(C)=O)SCCS1 |
| InChI | InChI=1S/C29H47NO7S2/c1-5-6-7-14-17-28(38-19-20-39-28)18-15-12-10-8-9-11-13-16-25-26(36-24(4)33)29(27(34)37-25,30-22(2)31)21-35-23(3)32/h11,13,25-26H,5-10,12,14-21H2,1-4H3,(H,30,31)/b13-11+/t25-,26+,29+/m1/s1 |
| InChIKey | IXWFEAORZNHINF-UERDJNTMSA-N |
| XLogP | 5.72 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.83 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|