C20H37NO3 — CID 70211952
2-[(Z)-hexadec-7-enyl]-1,3-dioxolane-2-carboxamide (PubChem CID 70211952) has the molecular formula C20H37NO3 and a molecular weight of 339.52 g/mol. Its IUPAC name is 2-[(Z)-hexadec-7-enyl]-1,3-dioxolane-2-carboxamide.
| Compound Name | 2-[(Z)-hexadec-7-enyl]-1,3-dioxolane-2-carboxamide |
|---|---|
| PubChem CID | 70211952 |
| Molecular Formula | C20H37NO3 |
| Molecular Weight | 339.52 g/mol |
| Exact Mass | 339.28 |
| IUPAC Name | 2-[(Z)-hexadec-7-enyl]-1,3-dioxolane-2-carboxamide |
| SMILES | CCCCCCCC/C=C\CCCCCCC1(C(N)=O)OCCO1 |
| InChI | InChI=1S/C20H37NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-20(19(21)22)23-17-18-24-20/h9-10H,2-8,11-18H2,1H3,(H2,21,22)/b10-9- |
| InChIKey | DJZAHNSLCGUOLQ-KTKRTIGZSA-N |
| XLogP | 4.86 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.52 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|