C14H16ClFN2S — CID 103947737
N-[2-(5-chlorothiophen-2-yl)ethyl]-1-(5-fluoro-2-pyridinyl)propan-1-amine (PubChem CID 103947737) has the molecular formula C14H16ClFN2S and a molecular weight of 298.81 g/mol. Its IUPAC name is N-[2-(5-chlorothiophen-2-yl)ethyl]-1-(5-fluoro-2-pyridinyl)propan-1-amine.
| Compound Name | N-[2-(5-chlorothiophen-2-yl)ethyl]-1-(5-fluoro-2-pyridinyl)propan-1-amine |
|---|---|
| PubChem CID | 103947737 |
| Molecular Formula | C14H16ClFN2S |
| Molecular Weight | 298.81 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | N-[2-(5-chlorothiophen-2-yl)ethyl]-1-(5-fluoro-2-pyridinyl)propan-1-amine |
| SMILES | CCC(NCCc1ccc(Cl)s1)c1ccc(F)cn1 |
| InChI | InChI=1S/C14H16ClFN2S/c1-2-12(13-5-3-10(16)9-18-13)17-8-7-11-4-6-14(15)19-11/h3-6,9,12,17H,2,7-8H2,1H3 |
| InChIKey | XUVCDUNAMPJYRC-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.81 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |