C38H53NO13 — CID 10395169
(2R,3R,4S,5R,6R)-3-amino-4,5-bis(methoxymethoxy)-6-[(1R,2R,3S)-1,2,3-tris(methoxymethoxy)-4-trityloxybutyl]oxan-2-ol (PubChem CID 10395169) has the molecular formula C38H53NO13 and a molecular weight of 731.84 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-3-amino-4,5-bis(methoxymethoxy)-6-[(1R,2R,3S)-1,2,3-tris(methoxymethoxy)-4-trityloxybutyl]oxan-2-ol.
| Compound Name | (2R,3R,4S,5R,6R)-3-amino-4,5-bis(methoxymethoxy)-6-[(1R,2R,3S)-1,2,3-tris(methoxymethoxy)-4-trityloxybutyl]oxan-2-ol |
|---|---|
| PubChem CID | 10395169 |
| Molecular Formula | C38H53NO13 |
| Molecular Weight | 731.84 g/mol |
| Exact Mass | 731.35 |
| IUPAC Name | (2R,3R,4S,5R,6R)-3-amino-4,5-bis(methoxymethoxy)-6-[(1R,2R,3S)-1,2,3-tris(methoxymethoxy)-4-trityloxybutyl]oxan-2-ol |
| SMILES | COCO[C@H]1[C@H]([C@H](OCOC)[C@H](OCOC)[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)OCOC)O[C@@H](O)[C@H](N)[C@@H]1OCOC |
| InChI | InChI=1S/C38H53NO13/c1-41-22-46-30(21-51-38(27-15-9-6-10-16-27,28-17-11-7-12-18-28)29-19-13-8-14-20-29)32(47-23-42-2)34(49-25-44-4)36-35(50-26-45-5)33(48-24-43-3)31(39)37(40)52-36/h6-20,30-37,40H,21-26,39H2,1-5H3/t30-,31+,32+,33-,34+,35+,36-,37+/m0/s1 |
| InChIKey | CJSIYEUNHOFIBX-YUXBANHKSA-N |
| XLogP | 2.99 |
| TPSA | 157.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.84 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|