C44H84ClNO6 — CID 10395336
2,3-bis[[(Z)-octadec-9-enoyl]oxy]propyl-(2,3-dihydroxypropyl)-dimethylazanium chloride (PubChem CID 10395336) has the molecular formula C44H84ClNO6 and a molecular weight of 758.61 g/mol. Its IUPAC name is 2,3-bis[[(Z)-octadec-9-enoyl]oxy]propyl-(2,3-dihydroxypropyl)-dimethylazanium chloride.
| Compound Name | 2,3-bis[[(Z)-octadec-9-enoyl]oxy]propyl-(2,3-dihydroxypropyl)-dimethylazanium chloride |
|---|---|
| PubChem CID | 10395336 |
| Molecular Formula | C44H84ClNO6 |
| Molecular Weight | 758.61 g/mol |
| Exact Mass | 757.60 |
| IUPAC Name | 2,3-bis[[(Z)-octadec-9-enoyl]oxy]propyl-(2,3-dihydroxypropyl)-dimethylazanium chloride |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCC(C[N+](C)(C)CC(O)CO)OC(=O)CCCCCCC/C=C\CCCCCCCC.[Cl-] |
| InChI | InChI=1S/C44H84NO6.ClH/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-43(48)50-40-42(38-45(3,4)37-41(47)39-46)51-44(49)36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2;/h19-22,41-42,46-47H,5-18,23-40H2,1-4H3;1H/q+1;/p-1/b21-19-,22-20-; |
| InChIKey | YRNBMOVBJJSKSF-JDVCJPALSA-M |
| XLogP | 7.95 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.61 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|