C15H21NO4S — CID 103973108
dimethyl 2-cyclopentyl-2-[(4-methyl-1,3-thiazol-2-yl)methyl]propanedioate (PubChem CID 103973108) has the molecular formula C15H21NO4S and a molecular weight of 311.40 g/mol. Its IUPAC name is dimethyl 2-cyclopentyl-2-[(4-methyl-1,3-thiazol-2-yl)methyl]propanedioate.
| Compound Name | dimethyl 2-cyclopentyl-2-[(4-methyl-1,3-thiazol-2-yl)methyl]propanedioate |
|---|---|
| PubChem CID | 103973108 |
| Molecular Formula | C15H21NO4S |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | dimethyl 2-cyclopentyl-2-[(4-methyl-1,3-thiazol-2-yl)methyl]propanedioate |
| SMILES | COC(=O)C(Cc1nc(C)cs1)(C(=O)OC)C1CCCC1 |
| InChI | InChI=1S/C15H21NO4S/c1-10-9-21-12(16-10)8-15(13(17)19-2,14(18)20-3)11-6-4-5-7-11/h9,11H,4-8H2,1-3H3 |
| InChIKey | AZFMFTIXGSTFOY-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|