C13H21F3O5 — CID 103974158
2-ethoxycarbonyl-2-propyl-5-(2,2,2-trifluoroethoxy)pentanoic acid (PubChem CID 103974158) has the molecular formula C13H21F3O5 and a molecular weight of 314.30 g/mol. Its IUPAC name is 2-ethoxycarbonyl-2-propyl-5-(2,2,2-trifluoroethoxy)pentanoic acid.
| Compound Name | 2-ethoxycarbonyl-2-propyl-5-(2,2,2-trifluoroethoxy)pentanoic acid |
|---|---|
| PubChem CID | 103974158 |
| Molecular Formula | C13H21F3O5 |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 2-ethoxycarbonyl-2-propyl-5-(2,2,2-trifluoroethoxy)pentanoic acid |
| SMILES | CCCC(CCCOCC(F)(F)F)(C(=O)O)C(=O)OCC |
| InChI | InChI=1S/C13H21F3O5/c1-3-6-12(10(17)18,11(19)21-4-2)7-5-8-20-9-13(14,15)16/h3-9H2,1-2H3,(H,17,18) |
| InChIKey | CFYYMQQXLZZXSB-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|