C11H20O6S — CID 103974464
2-ethoxycarbonyl-2-ethyl-5-methylsulfonylpentanoic acid (PubChem CID 103974464) has the molecular formula C11H20O6S and a molecular weight of 280.34 g/mol. Its IUPAC name is 2-ethoxycarbonyl-2-ethyl-5-methylsulfonylpentanoic acid.
| Compound Name | 2-ethoxycarbonyl-2-ethyl-5-methylsulfonylpentanoic acid |
|---|---|
| PubChem CID | 103974464 |
| Molecular Formula | C11H20O6S |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 2-ethoxycarbonyl-2-ethyl-5-methylsulfonylpentanoic acid |
| SMILES | CCOC(=O)C(CC)(CCCS(C)(=O)=O)C(=O)O |
| InChI | InChI=1S/C11H20O6S/c1-4-11(9(12)13,10(14)17-5-2)7-6-8-18(3,15)16/h4-8H2,1-3H3,(H,12,13) |
| InChIKey | CQAWQNZHPOSDBB-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|