C14H15NO5 — CID 10401270
benzyl (1R,2S,5S)-2-(methoxymethyl)-4-oxo-3-oxa-6-azabicyclo[3.1.0]hexane-6-carboxylate (PubChem CID 10401270) has the molecular formula C14H15NO5 and a molecular weight of 277.28 g/mol. Its IUPAC name is benzyl (1R,2S,5S)-2-(methoxymethyl)-4-oxo-3-oxa-6-azabicyclo[3.1.0]hexane-6-carboxylate.
| Compound Name | benzyl (1R,2S,5S)-2-(methoxymethyl)-4-oxo-3-oxa-6-azabicyclo[3.1.0]hexane-6-carboxylate |
|---|---|
| PubChem CID | 10401270 |
| Molecular Formula | C14H15NO5 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | benzyl (1R,2S,5S)-2-(methoxymethyl)-4-oxo-3-oxa-6-azabicyclo[3.1.0]hexane-6-carboxylate |
| SMILES | COC[C@H]1OC(=O)[C@@H]2[C@H]1N2C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C14H15NO5/c1-18-8-10-11-12(13(16)20-10)15(11)14(17)19-7-9-5-3-2-4-6-9/h2-6,10-12H,7-8H2,1H3/t10-,11+,12+,15?/m1/s1 |
| InChIKey | WJIURWUMIOCQKQ-ATUXAFSHSA-N |
| XLogP | 0.95 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|