C17H22O7 — CID 10404852
[(3aR,4S,7R,7aS)-7-acetyloxy-6-(furan-2-yl)-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-4-yl] acetate (PubChem CID 10404852) has the molecular formula C17H22O7 and a molecular weight of 338.36 g/mol. Its IUPAC name is [(3aR,4S,7R,7aS)-7-acetyloxy-6-(furan-2-yl)-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-4-yl] acetate.
| Compound Name | [(3aR,4S,7R,7aS)-7-acetyloxy-6-(furan-2-yl)-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-4-yl] acetate |
|---|---|
| PubChem CID | 10404852 |
| Molecular Formula | C17H22O7 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | [(3aR,4S,7R,7aS)-7-acetyloxy-6-(furan-2-yl)-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-4-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC(c2ccco2)[C@@H](OC(C)=O)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C17H22O7/c1-9(18)21-13-8-11(12-6-5-7-20-12)14(22-10(2)19)16-15(13)23-17(3,4)24-16/h5-7,11,13-16H,8H2,1-4H3/t11?,13-,14+,15+,16-/m0/s1 |
| InChIKey | MAHRTBNTKUPUML-POLXFIJQSA-N |
| XLogP | 2.15 |
| TPSA | 84.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |