C14H19N3O7 — CID 10405031
diethyl 2-amino-1-(ethoxycarbonylamino)-6-oxopyridine-3,5-dicarboxylate (PubChem CID 10405031) has the molecular formula C14H19N3O7 and a molecular weight of 341.32 g/mol. Its IUPAC name is diethyl 2-amino-1-(ethoxycarbonylamino)-6-oxopyridine-3,5-dicarboxylate.
| Compound Name | diethyl 2-amino-1-(ethoxycarbonylamino)-6-oxopyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 10405031 |
| Molecular Formula | C14H19N3O7 |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | diethyl 2-amino-1-(ethoxycarbonylamino)-6-oxopyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)Nn1c(N)c(C(=O)OCC)cc(C(=O)OCC)c1=O |
| InChI | InChI=1S/C14H19N3O7/c1-4-22-12(19)8-7-9(13(20)23-5-2)11(18)17(10(8)15)16-14(21)24-6-3/h7H,4-6,15H2,1-3H3,(H,16,21) |
| InChIKey | HVJHYTNFXZFZTM-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 138.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|