C22H30O3SSi — CID 10408831
S-phenyl (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-3-phenylpropanethioate (PubChem CID 10408831) has the molecular formula C22H30O3SSi and a molecular weight of 402.63 g/mol. Its IUPAC name is S-phenyl (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-3-phenylpropanethioate.
| Compound Name | S-phenyl (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-3-phenylpropanethioate |
|---|---|
| PubChem CID | 10408831 |
| Molecular Formula | C22H30O3SSi |
| Molecular Weight | 402.63 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | S-phenyl (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-3-phenylpropanethioate |
| SMILES | CO[C@@H](C(=O)Sc1ccccc1)[C@@H](O[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C22H30O3SSi/c1-22(2,3)27(5,6)25-19(17-13-9-7-10-14-17)20(24-4)21(23)26-18-15-11-8-12-16-18/h7-16,19-20H,1-6H3/t19-,20+/m0/s1 |
| InChIKey | PJEBJJBMEIWVOV-VQTJNVASSA-N |
| XLogP | 6.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.63 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|