C26H30O2S2Si — CID 14813334
(3R)-1,1-bis[(4-methylphenyl)sulfanyl]-3-phenyl-3-trimethylsilyloxypropan-2-one (PubChem CID 14813334) has the molecular formula C26H30O2S2Si and a molecular weight of 466.74 g/mol. Its IUPAC name is (3R)-1,1-bis[(4-methylphenyl)sulfanyl]-3-phenyl-3-trimethylsilyloxypropan-2-one.
| Compound Name | (3R)-1,1-bis[(4-methylphenyl)sulfanyl]-3-phenyl-3-trimethylsilyloxypropan-2-one |
|---|---|
| PubChem CID | 14813334 |
| Molecular Formula | C26H30O2S2Si |
| Molecular Weight | 466.74 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | (3R)-1,1-bis[(4-methylphenyl)sulfanyl]-3-phenyl-3-trimethylsilyloxypropan-2-one |
| SMILES | Cc1ccc(SC(Sc2ccc(C)cc2)C(=O)[C@H](O[Si](C)(C)C)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H30O2S2Si/c1-19-11-15-22(16-12-19)29-26(30-23-17-13-20(2)14-18-23)24(27)25(28-31(3,4)5)21-9-7-6-8-10-21/h6-18,25-26H,1-5H3/t25-/m1/s1 |
| InChIKey | RLPYJRSLMJCBRO-RUZDIDTESA-N |
| XLogP | 7.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.74 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|