C27H32OS2Si — CID 10624021
2,2-bis(phenylsulfanyl)ethyl-dimethyl-(3-methyl-1-phenylbut-3-enoxy)silane (PubChem CID 10624021) has the molecular formula C27H32OS2Si and a molecular weight of 464.77 g/mol. Its IUPAC name is 2,2-bis(phenylsulfanyl)ethyl-dimethyl-(3-methyl-1-phenylbut-3-enoxy)silane.
| Compound Name | 2,2-bis(phenylsulfanyl)ethyl-dimethyl-(3-methyl-1-phenylbut-3-enoxy)silane |
|---|---|
| PubChem CID | 10624021 |
| Molecular Formula | C27H32OS2Si |
| Molecular Weight | 464.77 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | 2,2-bis(phenylsulfanyl)ethyl-dimethyl-(3-methyl-1-phenylbut-3-enoxy)silane |
| SMILES | C=C(C)CC(O[Si](C)(C)CC(Sc1ccccc1)Sc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H32OS2Si/c1-22(2)20-26(23-14-8-5-9-15-23)28-31(3,4)21-27(29-24-16-10-6-11-17-24)30-25-18-12-7-13-19-25/h5-19,26-27H,1,20-21H2,2-4H3 |
| InChIKey | YZHUGCWOFQAWRG-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.77 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|