C24H36O3SSi2 — CID 10389557
S-phenyl (2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-phenyl-2-trimethylsilyloxypropanethioate (PubChem CID 10389557) has the molecular formula C24H36O3SSi2 and a molecular weight of 460.79 g/mol. Its IUPAC name is S-phenyl (2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-phenyl-2-trimethylsilyloxypropanethioate.
| Compound Name | S-phenyl (2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-phenyl-2-trimethylsilyloxypropanethioate |
|---|---|
| PubChem CID | 10389557 |
| Molecular Formula | C24H36O3SSi2 |
| Molecular Weight | 460.79 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | S-phenyl (2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-phenyl-2-trimethylsilyloxypropanethioate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](c1ccccc1)[C@H](O[Si](C)(C)C)C(=O)Sc1ccccc1 |
| InChI | InChI=1S/C24H36O3SSi2/c1-24(2,3)30(7,8)27-21(19-15-11-9-12-16-19)22(26-29(4,5)6)23(25)28-20-17-13-10-14-18-20/h9-18,21-22H,1-8H3/t21-,22-/m0/s1 |
| InChIKey | KLFZSKYIXUUJBO-VXKWHMMOSA-N |
| XLogP | 7.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.79 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|