C23H30O3SSi — CID 134832013
S-phenyl (4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3-oxo-4-phenylbutanethioate (PubChem CID 134832013) has the molecular formula C23H30O3SSi and a molecular weight of 414.64 g/mol. Its IUPAC name is S-phenyl (4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3-oxo-4-phenylbutanethioate.
| Compound Name | S-phenyl (4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3-oxo-4-phenylbutanethioate |
|---|---|
| PubChem CID | 134832013 |
| Molecular Formula | C23H30O3SSi |
| Molecular Weight | 414.64 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | S-phenyl (4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3-oxo-4-phenylbutanethioate |
| SMILES | CC(C(=O)Sc1ccccc1)C(=O)[C@H](O[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C23H30O3SSi/c1-17(22(25)27-19-15-11-8-12-16-19)20(24)21(18-13-9-7-10-14-18)26-28(5,6)23(2,3)4/h7-17,21H,1-6H3/t17?,21-/m1/s1 |
| InChIKey | MOGMATIAMIGUTI-FBLFFUNLSA-N |
| XLogP | 6.27 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.64 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|