C26H30OS2Si — CID 10551544
dimethyl-[1-phenyl-3,3-bis(phenylsulfanyl)propoxy]-prop-2-enylsilane (PubChem CID 10551544) has the molecular formula C26H30OS2Si and a molecular weight of 450.75 g/mol. Its IUPAC name is dimethyl-[1-phenyl-3,3-bis(phenylsulfanyl)propoxy]-prop-2-enylsilane.
| Compound Name | dimethyl-[1-phenyl-3,3-bis(phenylsulfanyl)propoxy]-prop-2-enylsilane |
|---|---|
| PubChem CID | 10551544 |
| Molecular Formula | C26H30OS2Si |
| Molecular Weight | 450.75 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | dimethyl-[1-phenyl-3,3-bis(phenylsulfanyl)propoxy]-prop-2-enylsilane |
| SMILES | C=CC[Si](C)(C)OC(CC(Sc1ccccc1)Sc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H30OS2Si/c1-4-20-30(2,3)27-25(22-14-8-5-9-15-22)21-26(28-23-16-10-6-11-17-23)29-24-18-12-7-13-19-24/h4-19,25-26H,1,20-21H2,2-3H3 |
| InChIKey | HWACWSLFHYHCFL-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.75 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|