About 3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylic acid
3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylic acid (PubChem CID 10410563) has the molecular formula C29H24N2O2
and a molecular weight of 432.52 g/mol. Its IUPAC name is 3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylic acid |
| PubChem CID | 10410563 |
| Molecular Formula | C29H24N2O2 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylic acid |
| SMILES | O=C(O)C1(c2ccccc2)N=C(c2ccccc2)N(Cc2ccccc2)C1c1ccccc1 |
| InChI | InChI=1S/C29H24N2O2/c32-28(33)29(25-19-11-4-12-20-25)26(23-15-7-2-8-16-23)31(21-22-13-5-1-6-14-22)27(30-29)24-17-9-3-10-18-24/h1-20,26H,21H2,(H,32,33) |
| InChIKey | SHAVOCVWHNDNMP-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylic acid?
The IUPAC name of 3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylic acid (CID 10410563) is 3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylic acid.
What is the SMILES notation for 3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylic acid?
The canonical SMILES for 3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylic acid is O=C(O)C1(c2ccccc2)N=C(c2ccccc2)N(Cc2ccccc2)C1c1ccccc1.
What is the InChIKey of 3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylic acid?
The InChIKey is SHAVOCVWHNDNMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H24N2O2/c32-28(33)29(25-19-11-4-12-20-25)26(23-15-7-2-8-16-23)31(21-22-13-5-1-6-14-22)27(30-29)24-17-9-3-10-18-24/h1-20,26H,21H2,(H,32,33).
What are the key properties of 3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylic acid?
3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylic acid has a molecular weight of 432.52 g/mol, XLogP of 5.67, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylic acid is sourced from PubChem (CID 10410563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).