3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylic acid

C29H24N2O2 — CID 10410563

IUPAC3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylic acid
SMILESO=C(O)C1(c2ccccc2)N=C(c2ccccc2)N(Cc2ccccc2)C1c1ccccc1
InChIInChI=1S/C29H24N2O2/c32-28(33)29(25-19-11-4-12-20-25)26(23-15-7-2-8-16-23)31(21-22-13-5-1-6-14-22)27(30-29)24-17-9-3-10-18-24/h1-20,26H,21H2,(H,32,33)
InChIKeySHAVOCVWHNDNMP-UHFFFAOYSA-N
MW432.52 g/mol
LogP5.67
Rot. Bonds6

About 3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylic acid

3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylic acid (PubChem CID 10410563) has the molecular formula C29H24N2O2 and a molecular weight of 432.52 g/mol. Its IUPAC name is 3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylic acid.

Molecular Properties

Compound Name3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylic acid
PubChem CID10410563
Molecular FormulaC29H24N2O2
Molecular Weight432.52 g/mol
Exact Mass432.18
IUPAC Name3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylic acid
SMILESO=C(O)C1(c2ccccc2)N=C(c2ccccc2)N(Cc2ccccc2)C1c1ccccc1
InChIInChI=1S/C29H24N2O2/c32-28(33)29(25-19-11-4-12-20-25)26(23-15-7-2-8-16-23)31(21-22-13-5-1-6-14-22)27(30-29)24-17-9-3-10-18-24/h1-20,26H,21H2,(H,32,33)
InChIKeySHAVOCVWHNDNMP-UHFFFAOYSA-N
XLogP5.67
TPSA52.90 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms33
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500432.52
LogP ≤ 55.67
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylic acid?
The IUPAC name of 3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylic acid (CID 10410563) is 3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylic acid.
What is the SMILES notation for 3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylic acid?
The canonical SMILES for 3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylic acid is O=C(O)C1(c2ccccc2)N=C(c2ccccc2)N(Cc2ccccc2)C1c1ccccc1.
What is the InChIKey of 3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylic acid?
The InChIKey is SHAVOCVWHNDNMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H24N2O2/c32-28(33)29(25-19-11-4-12-20-25)26(23-15-7-2-8-16-23)31(21-22-13-5-1-6-14-22)27(30-29)24-17-9-3-10-18-24/h1-20,26H,21H2,(H,32,33).
What are the key properties of 3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylic acid?
3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylic acid has a molecular weight of 432.52 g/mol, XLogP of 5.67, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylic acid is sourced from PubChem (CID 10410563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).