C23H30O6S — CID 10410672
ethyl (1S,2S,4aR,6S,8S,8aS)-6-[2-(benzenesulfonyl)propanoyl]-8-hydroxy-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carboxylate (PubChem CID 10410672) has the molecular formula C23H30O6S and a molecular weight of 434.55 g/mol. Its IUPAC name is ethyl (1S,2S,4aR,6S,8S,8aS)-6-[2-(benzenesulfonyl)propanoyl]-8-hydroxy-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carboxylate.
| Compound Name | ethyl (1S,2S,4aR,6S,8S,8aS)-6-[2-(benzenesulfonyl)propanoyl]-8-hydroxy-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 10410672 |
| Molecular Formula | C23H30O6S |
| Molecular Weight | 434.55 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | ethyl (1S,2S,4aR,6S,8S,8aS)-6-[2-(benzenesulfonyl)propanoyl]-8-hydroxy-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H]2[C@@H](O)C[C@@H](C(=O)C(C)S(=O)(=O)c3ccccc3)C[C@@H]2C=C[C@@H]1C |
| InChI | InChI=1S/C23H30O6S/c1-4-29-23(26)20-14(2)10-11-16-12-17(13-19(24)21(16)20)22(25)15(3)30(27,28)18-8-6-5-7-9-18/h5-11,14-17,19-21,24H,4,12-13H2,1-3H3/t14-,15?,16-,17-,19-,20-,21+/m0/s1 |
| InChIKey | XLXDIZFMCZQSSK-IUWZJOBXSA-N |
| XLogP | 2.81 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.55 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|