C19H22O4S — CID 166440200
(3R,3aS,8aR)-9-(benzenesulfonyl)-3-methyl-3a,5,6,7,8,8a,9,9a-octahydro-3H-benzo[f][2]benzofuran-1-one (PubChem CID 166440200) has the molecular formula C19H22O4S and a molecular weight of 346.45 g/mol. Its IUPAC name is (3R,3aS,8aR)-9-(benzenesulfonyl)-3-methyl-3a,5,6,7,8,8a,9,9a-octahydro-3H-benzo[f][2]benzofuran-1-one.
| Compound Name | (3R,3aS,8aR)-9-(benzenesulfonyl)-3-methyl-3a,5,6,7,8,8a,9,9a-octahydro-3H-benzo[f][2]benzofuran-1-one |
|---|---|
| PubChem CID | 166440200 |
| Molecular Formula | C19H22O4S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | (3R,3aS,8aR)-9-(benzenesulfonyl)-3-methyl-3a,5,6,7,8,8a,9,9a-octahydro-3H-benzo[f][2]benzofuran-1-one |
| SMILES | C[C@H]1OC(=O)C2C(S(=O)(=O)c3ccccc3)[C@@H]3CCCCC3=C[C@@H]21 |
| InChI | InChI=1S/C19H22O4S/c1-12-16-11-13-7-5-6-10-15(13)18(17(16)19(20)23-12)24(21,22)14-8-3-2-4-9-14/h2-4,8-9,11-12,15-18H,5-7,10H2,1H3/t12-,15-,16-,17?,18?/m1/s1 |
| InChIKey | LGNBBVLSKGRIST-BHMVCCJMSA-N |
| XLogP | 3.14 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|