C29H34N4O2 — CID 10412444
methyl 2-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]-N-propylanilino]-2-phenylacetate (PubChem CID 10412444) has the molecular formula C29H34N4O2 and a molecular weight of 470.62 g/mol. Its IUPAC name is methyl 2-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]-N-propylanilino]-2-phenylacetate.
| Compound Name | methyl 2-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]-N-propylanilino]-2-phenylacetate |
|---|---|
| PubChem CID | 10412444 |
| Molecular Formula | C29H34N4O2 |
| Molecular Weight | 470.62 g/mol |
| Exact Mass | 470.27 |
| IUPAC Name | methyl 2-[4-[(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]-N-propylanilino]-2-phenylacetate |
| SMILES | CCCN(c1ccc(Cn2c(CC)nc3c(C)cc(C)nc32)cc1)C(C(=O)OC)c1ccccc1 |
| InChI | InChI=1S/C29H34N4O2/c1-6-17-32(27(29(34)35-5)23-11-9-8-10-12-23)24-15-13-22(14-16-24)19-33-25(7-2)31-26-20(3)18-21(4)30-28(26)33/h8-16,18,27H,6-7,17,19H2,1-5H3 |
| InChIKey | MUYFLOLNOOOBPX-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.62 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|