C24H32FN5O3S — CID 10413246
(2R,3R,4S,5S)-2-[6-(2-ethylhexylamino)purin-9-yl]-5-[(2-fluorophenyl)sulfanylmethyl]oxolane-3,4-diol (PubChem CID 10413246) has the molecular formula C24H32FN5O3S and a molecular weight of 489.62 g/mol. Its IUPAC name is (2R,3R,4S,5S)-2-[6-(2-ethylhexylamino)purin-9-yl]-5-[(2-fluorophenyl)sulfanylmethyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5S)-2-[6-(2-ethylhexylamino)purin-9-yl]-5-[(2-fluorophenyl)sulfanylmethyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 10413246 |
| Molecular Formula | C24H32FN5O3S |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | (2R,3R,4S,5S)-2-[6-(2-ethylhexylamino)purin-9-yl]-5-[(2-fluorophenyl)sulfanylmethyl]oxolane-3,4-diol |
| SMILES | CCCCC(CC)CNc1ncnc2c1ncn2[C@@H]1O[C@H](CSc2ccccc2F)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C24H32FN5O3S/c1-3-5-8-15(4-2)11-26-22-19-23(28-13-27-22)30(14-29-19)24-21(32)20(31)17(33-24)12-34-18-10-7-6-9-16(18)25/h6-7,9-10,13-15,17,20-21,24,31-32H,3-5,8,11-12H2,1-2H3,(H,26,27,28)/t15?,17-,20-,21-,24-/m1/s1 |
| InChIKey | KDONNTVJWCFQHP-IFCMKCPTSA-N |
| XLogP | 4.01 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |