C28H54O5Si2 — CID 10414550
[(2S,8aR)-4a-[(Z)-2-[tert-butyl(dimethyl)silyl]oxyethenyl]-5-(2-methoxyethoxymethoxy)-2,5,6,7,8,8a-hexahydro-1H-naphthalen-2-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 10414550) has the molecular formula C28H54O5Si2 and a molecular weight of 526.91 g/mol. Its IUPAC name is [(2S,8aR)-4a-[(Z)-2-[tert-butyl(dimethyl)silyl]oxyethenyl]-5-(2-methoxyethoxymethoxy)-2,5,6,7,8,8a-hexahydro-1H-naphthalen-2-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(2S,8aR)-4a-[(Z)-2-[tert-butyl(dimethyl)silyl]oxyethenyl]-5-(2-methoxyethoxymethoxy)-2,5,6,7,8,8a-hexahydro-1H-naphthalen-2-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10414550 |
| Molecular Formula | C28H54O5Si2 |
| Molecular Weight | 526.91 g/mol |
| Exact Mass | 526.35 |
| IUPAC Name | [(2S,8aR)-4a-[(Z)-2-[tert-butyl(dimethyl)silyl]oxyethenyl]-5-(2-methoxyethoxymethoxy)-2,5,6,7,8,8a-hexahydro-1H-naphthalen-2-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | COCCOCOC1CCC[C@@H]2C[C@H](O[Si](C)(C)C(C)(C)C)C=CC12/C=C\O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H54O5Si2/c1-26(2,3)34(8,9)32-18-17-28-16-15-24(33-35(10,11)27(4,5)6)21-23(28)13-12-14-25(28)31-22-30-20-19-29-7/h15-18,23-25H,12-14,19-22H2,1-11H3/b18-17-/t23-,24-,25?,28?/m1/s1 |
| InChIKey | OEJPKVCRCMWBBP-MEMCABONSA-N |
| XLogP | 7.66 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.91 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|