C37H39NO3S — CID 10415791
(5S)-1-[(3S)-3-phenylsulfanylheptanoyl]-5-(trityloxymethyl)pyrrolidin-2-one (PubChem CID 10415791) has the molecular formula C37H39NO3S and a molecular weight of 577.79 g/mol. Its IUPAC name is (5S)-1-[(3S)-3-phenylsulfanylheptanoyl]-5-(trityloxymethyl)pyrrolidin-2-one.
| Compound Name | (5S)-1-[(3S)-3-phenylsulfanylheptanoyl]-5-(trityloxymethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 10415791 |
| Molecular Formula | C37H39NO3S |
| Molecular Weight | 577.79 g/mol |
| Exact Mass | 577.27 |
| IUPAC Name | (5S)-1-[(3S)-3-phenylsulfanylheptanoyl]-5-(trityloxymethyl)pyrrolidin-2-one |
| SMILES | CCCC[C@@H](CC(=O)N1C(=O)CC[C@H]1COC(c1ccccc1)(c1ccccc1)c1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C37H39NO3S/c1-2-3-22-34(42-33-23-14-7-15-24-33)27-36(40)38-32(25-26-35(38)39)28-41-37(29-16-8-4-9-17-29,30-18-10-5-11-19-30)31-20-12-6-13-21-31/h4-21,23-24,32,34H,2-3,22,25-28H2,1H3/t32-,34-/m0/s1 |
| InChIKey | HPSPHGMOCPIJFU-TWJUONSBSA-N |
| XLogP | 8.25 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.79 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|