C41H67O5P — CID 10417038
(3,5-ditert-butyl-2-hydroxyphenyl) [(3S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] hydrogen phosphate (PubChem CID 10417038) has the molecular formula C41H67O5P and a molecular weight of 670.96 g/mol. Its IUPAC name is (3,5-ditert-butyl-2-hydroxyphenyl) [(3S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] hydrogen phosphate.
| Compound Name | (3,5-ditert-butyl-2-hydroxyphenyl) [(3S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] hydrogen phosphate |
|---|---|
| PubChem CID | 10417038 |
| Molecular Formula | C41H67O5P |
| Molecular Weight | 670.96 g/mol |
| Exact Mass | 670.47 |
| IUPAC Name | (3,5-ditert-butyl-2-hydroxyphenyl) [(3S,9S,10R,13R,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] hydrogen phosphate |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2C3CC=C4C[C@@H](OP(=O)(O)Oc5cc(C(C)(C)C)cc(C(C)(C)C)c5O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C41H67O5P/c1-26(2)13-12-14-27(3)32-17-18-33-31-16-15-28-23-30(19-21-40(28,10)34(31)20-22-41(32,33)11)45-47(43,44)46-36-25-29(38(4,5)6)24-35(37(36)42)39(7,8)9/h15,24-27,30-34,42H,12-14,16-23H2,1-11H3,(H,43,44)/t27-,30+,31?,32-,33+,34+,40+,41-/m1/s1 |
| InChIKey | BNWJGMKIQLAGFC-QBSQRHDESA-N |
| XLogP | 11.89 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.96 |
| LogP ≤ 5 | 11.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|