C9H12N4O4 — CID 10421757
methyl (3R,4S)-3-acetamido-4-azido-3,4-dihydro-2H-pyran-6-carboxylate (PubChem CID 10421757) has the molecular formula C9H12N4O4 and a molecular weight of 240.22 g/mol. Its IUPAC name is methyl (3R,4S)-3-acetamido-4-azido-3,4-dihydro-2H-pyran-6-carboxylate.
| Compound Name | methyl (3R,4S)-3-acetamido-4-azido-3,4-dihydro-2H-pyran-6-carboxylate |
|---|---|
| PubChem CID | 10421757 |
| Molecular Formula | C9H12N4O4 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | methyl (3R,4S)-3-acetamido-4-azido-3,4-dihydro-2H-pyran-6-carboxylate |
| SMILES | COC(=O)C1=C[C@H](N=[N+]=[N-])[C@@H](NC(C)=O)CO1 |
| InChI | InChI=1S/C9H12N4O4/c1-5(14)11-7-4-17-8(9(15)16-2)3-6(7)12-13-10/h3,6-7H,4H2,1-2H3,(H,11,14)/t6-,7-/m0/s1 |
| InChIKey | ODEMLBZCPLKVAQ-BQBZGAKWSA-N |
| XLogP | 0.26 |
| TPSA | 113.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|