C18H24N4 — CID 10424667
2-[1-(4-tert-butylphenyl)-2-pyridin-4-ylethyl]guanidine (PubChem CID 10424667) has the molecular formula C18H24N4 and a molecular weight of 296.42 g/mol. Its IUPAC name is 2-[1-(4-tert-butylphenyl)-2-pyridin-4-ylethyl]guanidine.
| Compound Name | 2-[1-(4-tert-butylphenyl)-2-pyridin-4-ylethyl]guanidine |
|---|---|
| PubChem CID | 10424667 |
| Molecular Formula | C18H24N4 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | 2-[1-(4-tert-butylphenyl)-2-pyridin-4-ylethyl]guanidine |
| SMILES | CC(C)(C)c1ccc(C(Cc2ccncc2)N=C(N)N)cc1 |
| InChI | InChI=1S/C18H24N4/c1-18(2,3)15-6-4-14(5-7-15)16(22-17(19)20)12-13-8-10-21-11-9-13/h4-11,16H,12H2,1-3H3,(H4,19,20,22) |
| InChIKey | HDFXPVGISNSJES-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|