C17H17FN2OS — CID 10425900
3-[(2-fluorophenyl)methyl]-1,2,5,6,7,8-hexahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 10425900) has the molecular formula C17H17FN2OS and a molecular weight of 316.40 g/mol. Its IUPAC name is 3-[(2-fluorophenyl)methyl]-1,2,5,6,7,8-hexahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 3-[(2-fluorophenyl)methyl]-1,2,5,6,7,8-hexahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 10425900 |
| Molecular Formula | C17H17FN2OS |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 3-[(2-fluorophenyl)methyl]-1,2,5,6,7,8-hexahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | O=C1c2c(sc3c2CCCC3)NCN1Cc1ccccc1F |
| InChI | InChI=1S/C17H17FN2OS/c18-13-7-3-1-5-11(13)9-20-10-19-16-15(17(20)21)12-6-2-4-8-14(12)22-16/h1,3,5,7,19H,2,4,6,8-10H2 |
| InChIKey | MPOHTWQVSBFXCD-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |