C15H12N4O5 — CID 10426618
3-[[(E)-(4-nitrophenyl)methylideneamino]carbamoylamino]benzoic acid (PubChem CID 10426618) has the molecular formula C15H12N4O5 and a molecular weight of 328.28 g/mol. Its IUPAC name is 3-[[(E)-(4-nitrophenyl)methylideneamino]carbamoylamino]benzoic acid.
| Compound Name | 3-[[(E)-(4-nitrophenyl)methylideneamino]carbamoylamino]benzoic acid |
|---|---|
| PubChem CID | 10426618 |
| Molecular Formula | C15H12N4O5 |
| Molecular Weight | 328.28 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 3-[[(E)-(4-nitrophenyl)methylideneamino]carbamoylamino]benzoic acid |
| SMILES | O=C(N/N=C/c1ccc([N+](=O)[O-])cc1)Nc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C15H12N4O5/c20-14(21)11-2-1-3-12(8-11)17-15(22)18-16-9-10-4-6-13(7-5-10)19(23)24/h1-9H,(H,20,21)(H2,17,18,22)/b16-9+ |
| InChIKey | UNFPXXMZBNFACO-CXUHLZMHSA-N |
| XLogP | 2.45 |
| TPSA | 133.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.28 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|