C21H32O3 — CID 10426900
(1R,5S,9S)-9-[(3E)-4,8-dimethylnona-3,7-dienyl]-2,7-dioxatricyclo[7.3.0.01,5]dodecan-6-one (PubChem CID 10426900) has the molecular formula C21H32O3 and a molecular weight of 332.48 g/mol. Its IUPAC name is (1R,5S,9S)-9-[(3E)-4,8-dimethylnona-3,7-dienyl]-2,7-dioxatricyclo[7.3.0.01,5]dodecan-6-one.
| Compound Name | (1R,5S,9S)-9-[(3E)-4,8-dimethylnona-3,7-dienyl]-2,7-dioxatricyclo[7.3.0.01,5]dodecan-6-one |
|---|---|
| PubChem CID | 10426900 |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | (1R,5S,9S)-9-[(3E)-4,8-dimethylnona-3,7-dienyl]-2,7-dioxatricyclo[7.3.0.01,5]dodecan-6-one |
| SMILES | CC(C)=CCC/C(C)=C/CC[C@]12CCC[C@]13OCC[C@@H]3C(=O)OC2 |
| InChI | InChI=1S/C21H32O3/c1-16(2)7-4-8-17(3)9-5-11-20-12-6-13-21(20)18(10-14-24-21)19(22)23-15-20/h7,9,18H,4-6,8,10-15H2,1-3H3/b17-9+/t18-,20-,21-/m1/s1 |
| InChIKey | WTFCGJVRPSGOGX-PPCCBHAWSA-N |
| XLogP | 4.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|