C24H38O2SSi2 — CID 10433719
tert-butyl-dimethyl-[(1S,2S)-1-(4-methylphenyl)sulfanyl-2-phenyl-2-trimethylsilyloxyethoxy]silane (PubChem CID 10433719) has the molecular formula C24H38O2SSi2 and a molecular weight of 446.81 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(1S,2S)-1-(4-methylphenyl)sulfanyl-2-phenyl-2-trimethylsilyloxyethoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(1S,2S)-1-(4-methylphenyl)sulfanyl-2-phenyl-2-trimethylsilyloxyethoxy]silane |
|---|---|
| PubChem CID | 10433719 |
| Molecular Formula | C24H38O2SSi2 |
| Molecular Weight | 446.81 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | tert-butyl-dimethyl-[(1S,2S)-1-(4-methylphenyl)sulfanyl-2-phenyl-2-trimethylsilyloxyethoxy]silane |
| SMILES | Cc1ccc(S[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H38O2SSi2/c1-19-15-17-21(18-16-19)27-23(26-29(8,9)24(2,3)4)22(25-28(5,6)7)20-13-11-10-12-14-20/h10-18,22-23H,1-9H3/t22-,23-/m0/s1 |
| InChIKey | FOFLIZCMENZSBX-GOTSBHOMSA-N |
| XLogP | 8.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.81 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|