C31H49NO3Si — CID 10436419
tert-butyl (3S,4R)-3-[benzyl-[(1R)-1-phenylethyl]amino]-5-[tert-butyl(dimethyl)silyl]oxy-4-methylpentanoate (PubChem CID 10436419) has the molecular formula C31H49NO3Si and a molecular weight of 511.82 g/mol. Its IUPAC name is tert-butyl (3S,4R)-3-[benzyl-[(1R)-1-phenylethyl]amino]-5-[tert-butyl(dimethyl)silyl]oxy-4-methylpentanoate.
| Compound Name | tert-butyl (3S,4R)-3-[benzyl-[(1R)-1-phenylethyl]amino]-5-[tert-butyl(dimethyl)silyl]oxy-4-methylpentanoate |
|---|---|
| PubChem CID | 10436419 |
| Molecular Formula | C31H49NO3Si |
| Molecular Weight | 511.82 g/mol |
| Exact Mass | 511.35 |
| IUPAC Name | tert-butyl (3S,4R)-3-[benzyl-[(1R)-1-phenylethyl]amino]-5-[tert-butyl(dimethyl)silyl]oxy-4-methylpentanoate |
| SMILES | C[C@H](c1ccccc1)N(Cc1ccccc1)[C@@H](CC(=O)OC(C)(C)C)[C@@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H49NO3Si/c1-24(23-34-36(9,10)31(6,7)8)28(21-29(33)35-30(3,4)5)32(22-26-17-13-11-14-18-26)25(2)27-19-15-12-16-20-27/h11-20,24-25,28H,21-23H2,1-10H3/t24-,25+,28-/m0/s1 |
| InChIKey | CEIJAUSNSDEUDW-OARDWFSCSA-N |
| XLogP | 8.01 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.82 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|