About 2-propylsulfanylaniline
2-propylsulfanylaniline (PubChem CID 10442071) has the molecular formula C9H13NS
and a molecular weight of 167.28 g/mol. Its IUPAC name is 2-propylsulfanylaniline.
Molecular Properties
| Compound Name | 2-propylsulfanylaniline |
| PubChem CID | 10442071 |
| Molecular Formula | C9H13NS |
| Molecular Weight | 167.28 g/mol |
| Exact Mass | 167.08 |
| IUPAC Name | 2-propylsulfanylaniline |
| SMILES | CCCSc1ccccc1N |
| InChI | InChI=1S/C9H13NS/c1-2-7-11-9-6-4-3-5-8(9)10/h3-6H,2,7,10H2,1H3 |
| InChIKey | YFHQJDQHIXKPOS-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.28 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-propylsulfanylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propylsulfanylaniline?
The IUPAC name of 2-propylsulfanylaniline (CID 10442071) is 2-propylsulfanylaniline.
What is the SMILES notation for 2-propylsulfanylaniline?
The canonical SMILES for 2-propylsulfanylaniline is CCCSc1ccccc1N.
What is the InChIKey of 2-propylsulfanylaniline?
The InChIKey is YFHQJDQHIXKPOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NS/c1-2-7-11-9-6-4-3-5-8(9)10/h3-6H,2,7,10H2,1H3.
What are the key properties of 2-propylsulfanylaniline?
2-propylsulfanylaniline has a molecular weight of 167.28 g/mol, XLogP of 2.77, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propylsulfanylaniline is sourced from PubChem (CID 10442071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).