C16H16N4O — CID 10446386
5-phenyl-3-piperidin-1-yl-[1,2]oxazolo[4,5-d]pyrimidine (PubChem CID 10446386) has the molecular formula C16H16N4O and a molecular weight of 280.33 g/mol. Its IUPAC name is 5-phenyl-3-piperidin-1-yl-[1,2]oxazolo[4,5-d]pyrimidine.
| Compound Name | 5-phenyl-3-piperidin-1-yl-[1,2]oxazolo[4,5-d]pyrimidine |
|---|---|
| PubChem CID | 10446386 |
| Molecular Formula | C16H16N4O |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 5-phenyl-3-piperidin-1-yl-[1,2]oxazolo[4,5-d]pyrimidine |
| SMILES | c1ccc(-c2ncc3onc(N4CCCCC4)c3n2)cc1 |
| InChI | InChI=1S/C16H16N4O/c1-3-7-12(8-4-1)15-17-11-13-14(18-15)16(19-21-13)20-9-5-2-6-10-20/h1,3-4,7-8,11H,2,5-6,9-10H2 |
| InChIKey | QXELBQKCZPVSLZ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 55.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |