C17H18Cl2N2O — CID 19597556
6-phenyl-2-pyrrolidin-1-ylfuro[3,2-b]pyridine;dihydrochloride (PubChem CID 19597556) has the molecular formula C17H18Cl2N2O and a molecular weight of 337.25 g/mol. Its IUPAC name is 6-phenyl-2-pyrrolidin-1-ylfuro[3,2-b]pyridine;dihydrochloride.
| Compound Name | 6-phenyl-2-pyrrolidin-1-ylfuro[3,2-b]pyridine;dihydrochloride |
|---|---|
| PubChem CID | 19597556 |
| Molecular Formula | C17H18Cl2N2O |
| Molecular Weight | 337.25 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 6-phenyl-2-pyrrolidin-1-ylfuro[3,2-b]pyridine;dihydrochloride |
| SMILES | Cl.Cl.c1ccc(-c2cnc3cc(N4CCCC4)oc3c2)cc1 |
| InChI | InChI=1S/C17H16N2O.2ClH/c1-2-6-13(7-3-1)14-10-16-15(18-12-14)11-17(20-16)19-8-4-5-9-19;;/h1-3,6-7,10-12H,4-5,8-9H2;2*1H |
| InChIKey | BNYOGSNUJNDDQU-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.25 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |